C12H10F7NO — CID 571344
2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide (PubChem CID 571344) has the molecular formula C12H10F7NO and a molecular weight of 317.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 571344 |
| Molecular Formula | C12H10F7NO |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H10F7NO/c1-7(8-5-3-2-4-6-8)20-9(21)10(13,14)11(15,16)12(17,18)19/h2-7H,1H3,(H,20,21) |
| InChIKey | XVGDQPCIRYTQHC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|