About propyl N,N-bis(sulfanyl)carbamate
propyl N,N-bis(sulfanyl)carbamate (PubChem CID 57134701) has the molecular formula C4H9NO2S2
and a molecular weight of 167.25 g/mol. Its IUPAC name is propyl N,N-bis(sulfanyl)carbamate.
Molecular Properties
| Compound Name | propyl N,N-bis(sulfanyl)carbamate |
| PubChem CID | 57134701 |
| Molecular Formula | C4H9NO2S2 |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | propyl N,N-bis(sulfanyl)carbamate |
| SMILES | CCCOC(=O)N(S)S |
| InChI | InChI=1S/C4H9NO2S2/c1-2-3-7-4(6)5(8)9/h8-9H,2-3H2,1H3 |
| InChIKey | BHTLRCMIZFEKIA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propyl N,N-bis(sulfanyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N,N-bis(sulfanyl)carbamate?
The IUPAC name of propyl N,N-bis(sulfanyl)carbamate (CID 57134701) is propyl N,N-bis(sulfanyl)carbamate.
What is the SMILES notation for propyl N,N-bis(sulfanyl)carbamate?
The canonical SMILES for propyl N,N-bis(sulfanyl)carbamate is CCCOC(=O)N(S)S.
What is the InChIKey of propyl N,N-bis(sulfanyl)carbamate?
The InChIKey is BHTLRCMIZFEKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2S2/c1-2-3-7-4(6)5(8)9/h8-9H,2-3H2,1H3.
What are the key properties of propyl N,N-bis(sulfanyl)carbamate?
propyl N,N-bis(sulfanyl)carbamate has a molecular weight of 167.25 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N,N-bis(sulfanyl)carbamate is sourced from PubChem (CID 57134701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).