About 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine
3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine (PubChem CID 57134765) has the molecular formula C20H40N2
and a molecular weight of 308.55 g/mol. Its IUPAC name is 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine.
Molecular Properties
| Compound Name | 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine |
| PubChem CID | 57134765 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine |
| SMILES | CCCC1(CCC)CCC2(CCNC2C(C)(C)C(C)N)CC1 |
| InChI | InChI=1S/C20H40N2/c1-6-8-19(9-7-2)10-12-20(13-11-19)14-15-22-17(20)18(4,5)16(3)21/h16-17,22H,6-15,21H2,1-5H3 |
| InChIKey | FXXZETOSHKRUKR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine?
The IUPAC name of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine (CID 57134765) is 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine.
What is the SMILES notation for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine?
The canonical SMILES for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine is CCCC1(CCC)CCC2(CCNC2C(C)(C)C(C)N)CC1.
What is the InChIKey of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine?
The InChIKey is FXXZETOSHKRUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2/c1-6-8-19(9-7-2)10-12-20(13-11-19)14-15-22-17(20)18(4,5)16(3)21/h16-17,22H,6-15,21H2,1-5H3.
What are the key properties of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine?
3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine has a molecular weight of 308.55 g/mol, XLogP of 4.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-methylbutan-2-amine is sourced from PubChem (CID 57134765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).