C18H30O2 — CID 57134790
(6S)-6-[(1R,2R,3aS,6aR)-2-hydroxy-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]-4-methyloctan-3-one (PubChem CID 57134790) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (6S)-6-[(1R,2R,3aS,6aR)-2-hydroxy-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]-4-methyloctan-3-one.
| Compound Name | (6S)-6-[(1R,2R,3aS,6aR)-2-hydroxy-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]-4-methyloctan-3-one |
|---|---|
| PubChem CID | 57134790 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (6S)-6-[(1R,2R,3aS,6aR)-2-hydroxy-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]-4-methyloctan-3-one |
| SMILES | C=C1C[C@H]2C[C@@H](O)[C@H]([C@@H](CC)CC(C)C(=O)CC)[C@@H]2C1 |
| InChI | InChI=1S/C18H30O2/c1-5-13(9-12(4)16(19)6-2)18-15-8-11(3)7-14(15)10-17(18)20/h12-15,17-18,20H,3,5-10H2,1-2,4H3/t12?,13-,14-,15+,17+,18+/m0/s1 |
| InChIKey | PLXIGXFLJJKSAE-JFJMDWJOSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|