About 4,4-diamino-6,6-difluorononan-5-ol
4,4-diamino-6,6-difluorononan-5-ol (PubChem CID 57135139) has the molecular formula C9H20F2N2O
and a molecular weight of 210.27 g/mol. Its IUPAC name is 4,4-diamino-6,6-difluorononan-5-ol.
Molecular Properties
| Compound Name | 4,4-diamino-6,6-difluorononan-5-ol |
| PubChem CID | 57135139 |
| Molecular Formula | C9H20F2N2O |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4,4-diamino-6,6-difluorononan-5-ol |
| SMILES | CCCC(N)(N)C(O)C(F)(F)CCC |
| InChI | InChI=1S/C9H20F2N2O/c1-3-5-8(10,11)7(14)9(12,13)6-4-2/h7,14H,3-6,12-13H2,1-2H3 |
| InChIKey | NZOKCKJEYOVOTD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diamino-6,6-difluorononan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diamino-6,6-difluorononan-5-ol?
The IUPAC name of 4,4-diamino-6,6-difluorononan-5-ol (CID 57135139) is 4,4-diamino-6,6-difluorononan-5-ol.
What is the SMILES notation for 4,4-diamino-6,6-difluorononan-5-ol?
The canonical SMILES for 4,4-diamino-6,6-difluorononan-5-ol is CCCC(N)(N)C(O)C(F)(F)CCC.
What is the InChIKey of 4,4-diamino-6,6-difluorononan-5-ol?
The InChIKey is NZOKCKJEYOVOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20F2N2O/c1-3-5-8(10,11)7(14)9(12,13)6-4-2/h7,14H,3-6,12-13H2,1-2H3.
What are the key properties of 4,4-diamino-6,6-difluorononan-5-ol?
4,4-diamino-6,6-difluorononan-5-ol has a molecular weight of 210.27 g/mol, XLogP of 1.20, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diamino-6,6-difluorononan-5-ol is sourced from PubChem (CID 57135139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).