About 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene
1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene (PubChem CID 57135195) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 57135195 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C=CC=CC12C=CC(C=C1)C2 |
| InChI | InChI=1S/C11H12/c1-2-3-6-11-7-4-10(9-11)5-8-11/h2-8,10H,1,9H2 |
| InChIKey | BNOIBQGFDOQVLF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene (CID 57135195) is 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene is C=CC=CC12C=CC(C=C1)C2.
What is the InChIKey of 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is BNOIBQGFDOQVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-2-3-6-11-7-4-10(9-11)5-8-11/h2-8,10H,1,9H2.
What are the key properties of 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene?
1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 144.22 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dienylbicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 57135195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).