About 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol
1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol (PubChem CID 57136034) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol |
| PubChem CID | 57136034 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)COOCC(O)C(C)(C)C |
| InChI | InChI=1S/C12H26O4/c1-11(2,3)9(13)7-15-16-8-10(14)12(4,5)6/h9-10,13-14H,7-8H2,1-6H3 |
| InChIKey | QHSDHTYAVHZAHF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol?
The IUPAC name of 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol (CID 57136034) is 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol.
What is the SMILES notation for 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol?
The canonical SMILES for 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol is CC(C)(C)C(O)COOCC(O)C(C)(C)C.
What is the InChIKey of 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol?
The InChIKey is QHSDHTYAVHZAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4/c1-11(2,3)9(13)7-15-16-8-10(14)12(4,5)6/h9-10,13-14H,7-8H2,1-6H3.
What are the key properties of 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol?
1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol has a molecular weight of 234.34 g/mol, XLogP of 1.75, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-3,3-dimethylbutyl)peroxy-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 57136034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).