C25H24N2O2 — CID 57136209
3-[[3-(anilinomethyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-methyl-1H-indol-2-one (PubChem CID 57136209) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[[3-(anilinomethyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-methyl-1H-indol-2-one.
| Compound Name | 3-[[3-(anilinomethyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57136209 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[[3-(anilinomethyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-methyl-1H-indol-2-one |
| SMILES | Cc1ccc2c(c1)C(=Cc1oc3c(c1CNc1ccccc1)CCCC3)C(=O)N2 |
| InChI | InChI=1S/C25H24N2O2/c1-16-11-12-22-19(13-16)20(25(28)27-22)14-24-21(15-26-17-7-3-2-4-8-17)18-9-5-6-10-23(18)29-24/h2-4,7-8,11-14,26H,5-6,9-10,15H2,1H3,(H,27,28) |
| InChIKey | KPWCKAOFTJSLQK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|