C11H14O4S — CID 57136420
1-methoxy-3,4,5,6-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 57136420) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-methoxy-3,4,5,6-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 1-methoxy-3,4,5,6-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 57136420 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-methoxy-3,4,5,6-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | COC1=C(S(=O)(=O)O)CCC2=C1C=CCC2 |
| InChI | InChI=1S/C11H14O4S/c1-15-11-9-5-3-2-4-8(9)6-7-10(11)16(12,13)14/h3,5H,2,4,6-7H2,1H3,(H,12,13,14) |
| InChIKey | JXXJSKZHNIVBLN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|