C14H18N6O6S2 — CID 57136981
diamino 1-phenyl-2-(2,3,4,5-tetraaminophenyl)ethene-1,2-disulfonate (PubChem CID 57136981) has the molecular formula C14H18N6O6S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is diamino 1-phenyl-2-(2,3,4,5-tetraaminophenyl)ethene-1,2-disulfonate.
| Compound Name | diamino 1-phenyl-2-(2,3,4,5-tetraaminophenyl)ethene-1,2-disulfonate |
|---|---|
| PubChem CID | 57136981 |
| Molecular Formula | C14H18N6O6S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | diamino 1-phenyl-2-(2,3,4,5-tetraaminophenyl)ethene-1,2-disulfonate |
| SMILES | NOS(=O)(=O)C(=C(c1cc(N)c(N)c(N)c1N)S(=O)(=O)ON)c1ccccc1 |
| InChI | InChI=1S/C14H18N6O6S2/c15-9-6-8(10(16)12(18)11(9)17)14(28(23,24)26-20)13(27(21,22)25-19)7-4-2-1-3-5-7/h1-6H,15-20H2 |
| InChIKey | VKGIHXHULNIJEZ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 242.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|