C21H22BrFN2O3 — CID 57137268
(9S)-9-(3-bromo-4-fluorophenyl)-2-(2-ethoxyethyl)-3,5,6,7,8a,9-hexahydropyrrolo[3,4-b]quinoline-1,8-dione (PubChem CID 57137268) has the molecular formula C21H22BrFN2O3 and a molecular weight of 449.32 g/mol. Its IUPAC name is (9S)-9-(3-bromo-4-fluorophenyl)-2-(2-ethoxyethyl)-3,5,6,7,8a,9-hexahydropyrrolo[3,4-b]quinoline-1,8-dione.
| Compound Name | (9S)-9-(3-bromo-4-fluorophenyl)-2-(2-ethoxyethyl)-3,5,6,7,8a,9-hexahydropyrrolo[3,4-b]quinoline-1,8-dione |
|---|---|
| PubChem CID | 57137268 |
| Molecular Formula | C21H22BrFN2O3 |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (9S)-9-(3-bromo-4-fluorophenyl)-2-(2-ethoxyethyl)-3,5,6,7,8a,9-hexahydropyrrolo[3,4-b]quinoline-1,8-dione |
| SMILES | CCOCCN1CC2=C(C1=O)[C@H](c1ccc(F)c(Br)c1)C1C(=O)CCCC1=N2 |
| InChI | InChI=1S/C21H22BrFN2O3/c1-2-28-9-8-25-11-16-20(21(25)27)18(12-6-7-14(23)13(22)10-12)19-15(24-16)4-3-5-17(19)26/h6-7,10,18-19H,2-5,8-9,11H2,1H3/t18-,19?/m1/s1 |
| InChIKey | VCNUBPUCCBJLGO-MRTLOADZSA-N |
| XLogP | 3.63 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|