C30H29N3O4 — CID 57137491
[4-(1-hydroxy-2,2-diphenylethyl)-1-[(4-methoxy-3-methylphenyl)methyl]imidazo[4,5-c]pyridin-6-yl]methanediol (PubChem CID 57137491) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is [4-(1-hydroxy-2,2-diphenylethyl)-1-[(4-methoxy-3-methylphenyl)methyl]imidazo[4,5-c]pyridin-6-yl]methanediol.
| Compound Name | [4-(1-hydroxy-2,2-diphenylethyl)-1-[(4-methoxy-3-methylphenyl)methyl]imidazo[4,5-c]pyridin-6-yl]methanediol |
|---|---|
| PubChem CID | 57137491 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [4-(1-hydroxy-2,2-diphenylethyl)-1-[(4-methoxy-3-methylphenyl)methyl]imidazo[4,5-c]pyridin-6-yl]methanediol |
| SMILES | COc1ccc(Cn2cnc3c(C(O)C(c4ccccc4)c4ccccc4)nc(C(O)O)cc32)cc1C |
| InChI | InChI=1S/C30H29N3O4/c1-19-15-20(13-14-25(19)37-2)17-33-18-31-27-24(33)16-23(30(35)36)32-28(27)29(34)26(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,18,26,29-30,34-36H,17H2,1-2H3 |
| InChIKey | MRAVQYVLTKDRLW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|