C45H63N3O3 — CID 57137559
2,4,6-tris(3,5-ditert-butylphenoxy)-1,3,5-triazine (PubChem CID 57137559) has the molecular formula C45H63N3O3 and a molecular weight of 694.02 g/mol. Its IUPAC name is 2,4,6-tris(3,5-ditert-butylphenoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3,5-ditert-butylphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 57137559 |
| Molecular Formula | C45H63N3O3 |
| Molecular Weight | 694.02 g/mol |
| Exact Mass | 693.49 |
| IUPAC Name | 2,4,6-tris(3,5-ditert-butylphenoxy)-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(Oc2nc(Oc3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(Oc3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H63N3O3/c1-40(2,3)28-19-29(41(4,5)6)23-34(22-28)49-37-46-38(50-35-24-30(42(7,8)9)20-31(25-35)43(10,11)12)48-39(47-37)51-36-26-32(44(13,14)15)21-33(27-36)45(16,17)18/h19-27H,1-18H3 |
| InChIKey | BZHJSQVYTIOBIX-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.02 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |