About CID 57137649
CID 57137649 (PubChem CID 57137649) has the molecular formula C14H8BN2O2
and a molecular weight of 247.04 g/mol.
Molecular Properties
| Compound Name | CID 57137649 |
| PubChem CID | 57137649 |
| Molecular Formula | C14H8BN2O2 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | — |
| SMILES | N#Cc1cccc(O[B]Oc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C14H8BN2O2/c16-9-11-3-1-5-13(7-11)18-15-19-14-6-2-4-12(8-14)10-17/h1-8H |
| InChIKey | WMHQWZUQLMDBAC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57137649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57137649?
The IUPAC name of CID 57137649 (CID 57137649) is not available.
What is the SMILES notation for CID 57137649?
The canonical SMILES for CID 57137649 is N#Cc1cccc(O[B]Oc2cccc(C#N)c2)c1.
What is the InChIKey of CID 57137649?
The InChIKey is WMHQWZUQLMDBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BN2O2/c16-9-11-3-1-5-13(7-11)18-15-19-14-6-2-4-12(8-14)10-17/h1-8H.
What are the key properties of CID 57137649?
CID 57137649 has a molecular weight of 247.04 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57137649 is sourced from PubChem (CID 57137649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).