C28H28F3N5O4 — CID 57138211
(4S,5R)-3-N-[(3R)-1-[4-(2-cyano-4-fluorophenyl)cyclohexyl]pyrrolidin-3-yl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3,5-dicarboxamide (PubChem CID 57138211) has the molecular formula C28H28F3N5O4 and a molecular weight of 555.56 g/mol. Its IUPAC name is (4S,5R)-3-N-[(3R)-1-[4-(2-cyano-4-fluorophenyl)cyclohexyl]pyrrolidin-3-yl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3,5-dicarboxamide.
| Compound Name | (4S,5R)-3-N-[(3R)-1-[4-(2-cyano-4-fluorophenyl)cyclohexyl]pyrrolidin-3-yl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 57138211 |
| Molecular Formula | C28H28F3N5O4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (4S,5R)-3-N-[(3R)-1-[4-(2-cyano-4-fluorophenyl)cyclohexyl]pyrrolidin-3-yl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3,5-dicarboxamide |
| SMILES | N#Cc1cc(F)ccc1C1CCC(N2CC[C@@H](NC(=O)N3C(=O)O[C@@H](C(N)=O)[C@@H]3c3ccc(F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C28H28F3N5O4/c29-18-4-7-21(17(11-18)13-32)15-1-5-20(6-2-15)35-10-9-19(14-35)34-27(38)36-24(25(26(33)37)40-28(36)39)16-3-8-22(30)23(31)12-16/h3-4,7-8,11-12,15,19-20,24-25H,1-2,5-6,9-10,14H2,(H2,33,37)(H,34,38)/t15?,19-,20?,24+,25-/m1/s1 |
| InChIKey | GVFOBVWURAEXJL-JLTMBHRLSA-N |
| XLogP | 3.83 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |