About 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole
1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole (PubChem CID 57138416) has the molecular formula C19H19ClN2O
and a molecular weight of 326.83 g/mol. Its IUPAC name is 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole |
| PubChem CID | 57138416 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole |
| SMILES | Cc1cnc(C)n1Cc1ccc(OCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H19ClN2O/c1-14-11-21-15(2)22(14)12-17-8-9-18(10-19(17)20)23-13-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | FPBRNDAOGNHMHJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole?
The IUPAC name of 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole (CID 57138416) is 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole.
What is the SMILES notation for 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole?
The canonical SMILES for 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole is Cc1cnc(C)n1Cc1ccc(OCc2ccccc2)cc1Cl.
What is the InChIKey of 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole?
The InChIKey is FPBRNDAOGNHMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O/c1-14-11-21-15(2)22(14)12-17-8-9-18(10-19(17)20)23-13-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3.
What are the key properties of 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole?
1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole has a molecular weight of 326.83 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-4-phenylmethoxyphenyl)methyl]-2,5-dimethylimidazole is sourced from PubChem (CID 57138416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).