C7H8N2O — CID 57138947
6-diazo-2-methoxycyclohexa-1,3-diene (PubChem CID 57138947) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 6-diazo-2-methoxycyclohexa-1,3-diene.
| Compound Name | 6-diazo-2-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 57138947 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 6-diazo-2-methoxycyclohexa-1,3-diene |
| SMILES | COC1=CC(=[N+]=[N-])CC=C1 |
| InChI | InChI=1S/C7H8N2O/c1-10-7-4-2-3-6(5-7)9-8/h2,4-5H,3H2,1H3 |
| InChIKey | ULVCROKRLINNBS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|