About [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol
[(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol (PubChem CID 57139163) has the molecular formula C5H7ClFN5O2
and a molecular weight of 223.59 g/mol. Its IUPAC name is [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol.
Molecular Properties
| Compound Name | [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol |
| PubChem CID | 57139163 |
| Molecular Formula | C5H7ClFN5O2 |
| Molecular Weight | 223.59 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol |
| SMILES | Nc1nc(Cl)c(N)c(NC(O)(O)F)n1 |
| InChI | InChI=1S/C5H7ClFN5O2/c6-2-1(8)3(11-4(9)10-2)12-5(7,13)14/h13-14H,8H2,(H3,9,10,11,12) |
| InChIKey | ZUPAFAKNOQYEFJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.59 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol?
The IUPAC name of [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol (CID 57139163) is [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol.
What is the SMILES notation for [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol?
The canonical SMILES for [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol is Nc1nc(Cl)c(N)c(NC(O)(O)F)n1.
What is the InChIKey of [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol?
The InChIKey is ZUPAFAKNOQYEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClFN5O2/c6-2-1(8)3(11-4(9)10-2)12-5(7,13)14/h13-14H,8H2,(H3,9,10,11,12).
What are the key properties of [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol?
[(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol has a molecular weight of 223.59 g/mol, XLogP of -0.73, 2 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,5-diamino-6-chloropyrimidin-4-yl)amino]-fluoromethanediol is sourced from PubChem (CID 57139163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).