About 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine
3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine (PubChem CID 57139222) has the molecular formula C22H44N2
and a molecular weight of 336.61 g/mol. Its IUPAC name is 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine.
Molecular Properties
| Compound Name | 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine |
| PubChem CID | 57139222 |
| Molecular Formula | C22H44N2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.35 |
| IUPAC Name | 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine |
| SMILES | CCCC1(CCC)CCC2(CCNC2C(CC)(CC)C(C)N)CC1 |
| InChI | InChI=1S/C22H44N2/c1-6-10-20(11-7-2)12-14-21(15-13-20)16-17-24-19(21)22(8-3,9-4)18(5)23/h18-19,24H,6-17,23H2,1-5H3 |
| InChIKey | HKEZLCCLZXLWIZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine?
The IUPAC name of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine (CID 57139222) is 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine.
What is the SMILES notation for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine?
The canonical SMILES for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine is CCCC1(CCC)CCC2(CCNC2C(CC)(CC)C(C)N)CC1.
What is the InChIKey of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine?
The InChIKey is HKEZLCCLZXLWIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44N2/c1-6-10-20(11-7-2)12-14-21(15-13-20)16-17-24-19(21)22(8-3,9-4)18(5)23/h18-19,24H,6-17,23H2,1-5H3.
What are the key properties of 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine?
3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine has a molecular weight of 336.61 g/mol, XLogP of 5.65, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8,8-dipropyl-2-azaspiro[4.5]decan-1-yl)-3-ethylpentan-2-amine is sourced from PubChem (CID 57139222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).