About trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane
trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane (PubChem CID 57139561) has the molecular formula C11H21F3OSi
and a molecular weight of 254.37 g/mol. Its IUPAC name is trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane.
Molecular Properties
| Compound Name | trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane |
| PubChem CID | 57139561 |
| Molecular Formula | C11H21F3OSi |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane |
| SMILES | C=CCC(CC(C)C(F)(F)F)O[Si](C)(C)C |
| InChI | InChI=1S/C11H21F3OSi/c1-6-7-10(15-16(3,4)5)8-9(2)11(12,13)14/h6,9-10H,1,7-8H2,2-5H3 |
| InChIKey | AKPSRYFLLUPVDW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane?
The IUPAC name of trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane (CID 57139561) is trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane.
What is the SMILES notation for trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane?
The canonical SMILES for trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane is C=CCC(CC(C)C(F)(F)F)O[Si](C)(C)C.
What is the InChIKey of trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane?
The InChIKey is AKPSRYFLLUPVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3OSi/c1-6-7-10(15-16(3,4)5)8-9(2)11(12,13)14/h6,9-10H,1,7-8H2,2-5H3.
What are the key properties of trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane?
trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane has a molecular weight of 254.37 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(7,7,7-trifluoro-6-methylhept-1-en-4-yl)oxysilane is sourced from PubChem (CID 57139561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).