About 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide
3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide (PubChem CID 57139592) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide |
| PubChem CID | 57139592 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide |
| SMILES | CC(=O)NC(C)(O)C(C)(C)C(=O)NCCO |
| InChI | InChI=1S/C10H20N2O4/c1-7(14)12-10(4,16)9(2,3)8(15)11-5-6-13/h13,16H,5-6H2,1-4H3,(H,11,15)(H,12,14) |
| InChIKey | BMULUOFZXZNWGD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide?
The IUPAC name of 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide (CID 57139592) is 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide.
What is the SMILES notation for 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide?
The canonical SMILES for 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide is CC(=O)NC(C)(O)C(C)(C)C(=O)NCCO.
What is the InChIKey of 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide?
The InChIKey is BMULUOFZXZNWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-7(14)12-10(4,16)9(2,3)8(15)11-5-6-13/h13,16H,5-6H2,1-4H3,(H,11,15)(H,12,14).
What are the key properties of 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide?
3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide has a molecular weight of 232.28 g/mol, XLogP of -1.03, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-3-hydroxy-N-(2-hydroxyethyl)-2,2-dimethylbutanamide is sourced from PubChem (CID 57139592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).