C28H29BrN2O2 — CID 57139651
3-[[3-(1-anilinobutyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-bromo-4-methyl-1H-indol-2-one (PubChem CID 57139651) has the molecular formula C28H29BrN2O2 and a molecular weight of 505.46 g/mol. Its IUPAC name is 3-[[3-(1-anilinobutyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-bromo-4-methyl-1H-indol-2-one.
| Compound Name | 3-[[3-(1-anilinobutyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-bromo-4-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57139651 |
| Molecular Formula | C28H29BrN2O2 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 3-[[3-(1-anilinobutyl)-4,5,6,7-tetrahydro-1-benzofuran-2-yl]methylidene]-5-bromo-4-methyl-1H-indol-2-one |
| SMILES | CCCC(Nc1ccccc1)c1c(C=C2C(=O)Nc3ccc(Br)c(C)c32)oc2c1CCCC2 |
| InChI | InChI=1S/C28H29BrN2O2/c1-3-9-22(30-18-10-5-4-6-11-18)27-19-12-7-8-13-24(19)33-25(27)16-20-26-17(2)21(29)14-15-23(26)31-28(20)32/h4-6,10-11,14-16,22,30H,3,7-9,12-13H2,1-2H3,(H,31,32) |
| InChIKey | HFZCAZXDXCKHGD-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|