About [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate
[2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate (PubChem CID 57139885) has the molecular formula C10H18O8
and a molecular weight of 266.25 g/mol. Its IUPAC name is [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate |
| PubChem CID | 57139885 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC(C(O)O)(C(O)O)C(O)O |
| InChI | InChI=1S/C10H18O8/c1-3-5(2)6(11)18-4-10(7(12)13,8(14)15)9(16)17/h3,7-9,12-17H,4H2,1-2H3 |
| InChIKey | CLRJFGVPKPMMPO-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate?
The IUPAC name of [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate (CID 57139885) is [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate.
What is the SMILES notation for [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate?
The canonical SMILES for [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate is CC=C(C)C(=O)OCC(C(O)O)(C(O)O)C(O)O.
What is the InChIKey of [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate?
The InChIKey is CLRJFGVPKPMMPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O8/c1-3-5(2)6(11)18-4-10(7(12)13,8(14)15)9(16)17/h3,7-9,12-17H,4H2,1-2H3.
What are the key properties of [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate?
[2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate has a molecular weight of 266.25 g/mol, XLogP of -2.59, 6 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-bis(dihydroxymethyl)-3,3-dihydroxypropyl] 2-methylbut-2-enoate is sourced from PubChem (CID 57139885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).