C20H26O4 — CID 57140544
3,10-dioxatricyclo[14.2.2.25,8]docosa-5,7,21-triene-4,9-dione (PubChem CID 57140544) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 3,10-dioxatricyclo[14.2.2.25,8]docosa-5,7,21-triene-4,9-dione.
| Compound Name | 3,10-dioxatricyclo[14.2.2.25,8]docosa-5,7,21-triene-4,9-dione |
|---|---|
| PubChem CID | 57140544 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3,10-dioxatricyclo[14.2.2.25,8]docosa-5,7,21-triene-4,9-dione |
| SMILES | O=C1OCCCCCC2CCC(CC2)COC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C20H26O4/c21-19-17-9-11-18(12-10-17)20(22)24-14-16-7-5-15(6-8-16)4-2-1-3-13-23-19/h9-12,15-16H,1-8,13-14H2 |
| InChIKey | AABTXLDURZNMPD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |