C14H7Cl8NO — CID 57140613
2-[2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)anilino]ethanol (PubChem CID 57140613) has the molecular formula C14H7Cl8NO and a molecular weight of 488.84 g/mol. Its IUPAC name is 2-[2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)anilino]ethanol.
| Compound Name | 2-[2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)anilino]ethanol |
|---|---|
| PubChem CID | 57140613 |
| Molecular Formula | C14H7Cl8NO |
| Molecular Weight | 488.84 g/mol |
| Exact Mass | 484.80 |
| IUPAC Name | 2-[2,3,4-trichloro-5-(2,3,4,5,6-pentachlorophenyl)anilino]ethanol |
| SMILES | OCCNc1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H7Cl8NO/c15-7-4(3-5(23-1-2-24)8(16)11(7)19)6-9(17)12(20)14(22)13(21)10(6)18/h3,23-24H,1-2H2 |
| InChIKey | IJXCWQTYJAEWSL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.84 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|