C24H28F2N4O4 — CID 57141062
(4S)-4-(3,4-difluorophenyl)-N-[2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide (PubChem CID 57141062) has the molecular formula C24H28F2N4O4 and a molecular weight of 474.51 g/mol. Its IUPAC name is (4S)-4-(3,4-difluorophenyl)-N-[2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide.
| Compound Name | (4S)-4-(3,4-difluorophenyl)-N-[2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 57141062 |
| Molecular Formula | C24H28F2N4O4 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (4S)-4-(3,4-difluorophenyl)-N-[2-[[1-(2-methoxyphenyl)piperidin-4-yl]amino]ethyl]-2-oxo-1,3-oxazolidine-3-carboxamide |
| SMILES | COc1ccccc1N1CCC(NCCNC(=O)N2C(=O)OC[C@@H]2c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H28F2N4O4/c1-33-22-5-3-2-4-20(22)29-12-8-17(9-13-29)27-10-11-28-23(31)30-21(15-34-24(30)32)16-6-7-18(25)19(26)14-16/h2-7,14,17,21,27H,8-13,15H2,1H3,(H,28,31)/t21-/m1/s1 |
| InChIKey | QMKOXVJKZVJSHO-OAQYLSRUSA-N |
| XLogP | 3.43 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|