C16H24O3 — CID 57141646
6-hydroxy-3-(3-methoxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 57141646) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-hydroxy-3-(3-methoxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 6-hydroxy-3-(3-methoxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 57141646 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 6-hydroxy-3-(3-methoxy-3-methylpenta-1,4-dienyl)-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | C=CC(C)(C=CC1=C(C)C(=O)C(O)CC1(C)C)OC |
| InChI | InChI=1S/C16H24O3/c1-7-16(5,19-6)9-8-12-11(2)14(18)13(17)10-15(12,3)4/h7-9,13,17H,1,10H2,2-6H3 |
| InChIKey | OWIQVICBNGQSPK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|