C15H20O5 — CID 57142013
4-(cyclopropanecarbonyl)-1-(2-methylpropyl)-3,5-dioxocyclohexane-1-carboxylic acid (PubChem CID 57142013) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-(cyclopropanecarbonyl)-1-(2-methylpropyl)-3,5-dioxocyclohexane-1-carboxylic acid.
| Compound Name | 4-(cyclopropanecarbonyl)-1-(2-methylpropyl)-3,5-dioxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57142013 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-(cyclopropanecarbonyl)-1-(2-methylpropyl)-3,5-dioxocyclohexane-1-carboxylic acid |
| SMILES | CC(C)CC1(C(=O)O)CC(=O)C(C(=O)C2CC2)C(=O)C1 |
| InChI | InChI=1S/C15H20O5/c1-8(2)5-15(14(19)20)6-10(16)12(11(17)7-15)13(18)9-3-4-9/h8-9,12H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | GAORVIHXBVNHRP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|