C11H17NO6S — CID 57142091
3-[(3-acetylsulfanyl-2-methylpropanoyl)-(carboxymethyl)amino]propanoic acid (PubChem CID 57142091) has the molecular formula C11H17NO6S and a molecular weight of 291.32 g/mol. Its IUPAC name is 3-[(3-acetylsulfanyl-2-methylpropanoyl)-(carboxymethyl)amino]propanoic acid.
| Compound Name | 3-[(3-acetylsulfanyl-2-methylpropanoyl)-(carboxymethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 57142091 |
| Molecular Formula | C11H17NO6S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[(3-acetylsulfanyl-2-methylpropanoyl)-(carboxymethyl)amino]propanoic acid |
| SMILES | CC(=O)SCC(C)C(=O)N(CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H17NO6S/c1-7(6-19-8(2)13)11(18)12(5-10(16)17)4-3-9(14)15/h7H,3-6H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | KOZDIIPBKGCKOW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|