C12H15NO — CID 57142307
1-(1,2,3,4-tetrahydroquinolin-5-yl)propan-1-one (PubChem CID 57142307) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroquinolin-5-yl)propan-1-one.
| Compound Name | 1-(1,2,3,4-tetrahydroquinolin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 57142307 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroquinolin-5-yl)propan-1-one |
| SMILES | CCC(=O)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C12H15NO/c1-2-12(14)10-5-3-7-11-9(10)6-4-8-13-11/h3,5,7,13H,2,4,6,8H2,1H3 |
| InChIKey | VOGOJDMZXCAZHO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |