C25H37F3N2O3S — CID 57142534
6-piperidin-1-yl-1-[(4R)-4-propyl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]hexan-1-one (PubChem CID 57142534) has the molecular formula C25H37F3N2O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is 6-piperidin-1-yl-1-[(4R)-4-propyl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]hexan-1-one.
| Compound Name | 6-piperidin-1-yl-1-[(4R)-4-propyl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 57142534 |
| Molecular Formula | C25H37F3N2O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 6-piperidin-1-yl-1-[(4R)-4-propyl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]hexan-1-one |
| SMILES | CCC[C@H]1CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1C(=O)CCCCCN1CCCCC1 |
| InChI | InChI=1S/C25H37F3N2O3S/c1-2-9-20-18-30(34(32,33)22-13-11-21(12-14-22)25(26,27)28)19-23(20)24(31)10-5-3-6-15-29-16-7-4-8-17-29/h11-14,20,23H,2-10,15-19H2,1H3/t20-,23?/m0/s1 |
| InChIKey | PEBSWMMAHJWACI-AJZOCDQUSA-N |
| XLogP | 5.36 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|