About 2,2-dimethyl-3,5-dioxohexanoic acid
2,2-dimethyl-3,5-dioxohexanoic acid (PubChem CID 57142628) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2,2-dimethyl-3,5-dioxohexanoic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-3,5-dioxohexanoic acid |
| PubChem CID | 57142628 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2,2-dimethyl-3,5-dioxohexanoic acid |
| SMILES | CC(=O)CC(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-5(9)4-6(10)8(2,3)7(11)12/h4H2,1-3H3,(H,11,12) |
| InChIKey | QBZCDBWKKQPISS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3,5-dioxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3,5-dioxohexanoic acid?
The IUPAC name of 2,2-dimethyl-3,5-dioxohexanoic acid (CID 57142628) is 2,2-dimethyl-3,5-dioxohexanoic acid.
What is the SMILES notation for 2,2-dimethyl-3,5-dioxohexanoic acid?
The canonical SMILES for 2,2-dimethyl-3,5-dioxohexanoic acid is CC(=O)CC(=O)C(C)(C)C(=O)O.
What is the InChIKey of 2,2-dimethyl-3,5-dioxohexanoic acid?
The InChIKey is QBZCDBWKKQPISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-5(9)4-6(10)8(2,3)7(11)12/h4H2,1-3H3,(H,11,12).
What are the key properties of 2,2-dimethyl-3,5-dioxohexanoic acid?
2,2-dimethyl-3,5-dioxohexanoic acid has a molecular weight of 172.18 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3,5-dioxohexanoic acid is sourced from PubChem (CID 57142628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).