About 3-(4-bromophenyl)-2,5-dichlorobenzenethiol
3-(4-bromophenyl)-2,5-dichlorobenzenethiol (PubChem CID 57142660) has the molecular formula C12H7BrCl2S
and a molecular weight of 334.07 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2,5-dichlorobenzenethiol.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-2,5-dichlorobenzenethiol |
| PubChem CID | 57142660 |
| Molecular Formula | C12H7BrCl2S |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 3-(4-bromophenyl)-2,5-dichlorobenzenethiol |
| SMILES | Sc1cc(Cl)cc(-c2ccc(Br)cc2)c1Cl |
| InChI | InChI=1S/C12H7BrCl2S/c13-8-3-1-7(2-4-8)10-5-9(14)6-11(16)12(10)15/h1-6,16H |
| InChIKey | FKWSULLFJGWWBD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)-2,5-dichlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-2,5-dichlorobenzenethiol?
The IUPAC name of 3-(4-bromophenyl)-2,5-dichlorobenzenethiol (CID 57142660) is 3-(4-bromophenyl)-2,5-dichlorobenzenethiol.
What is the SMILES notation for 3-(4-bromophenyl)-2,5-dichlorobenzenethiol?
The canonical SMILES for 3-(4-bromophenyl)-2,5-dichlorobenzenethiol is Sc1cc(Cl)cc(-c2ccc(Br)cc2)c1Cl.
What is the InChIKey of 3-(4-bromophenyl)-2,5-dichlorobenzenethiol?
The InChIKey is FKWSULLFJGWWBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrCl2S/c13-8-3-1-7(2-4-8)10-5-9(14)6-11(16)12(10)15/h1-6,16H.
What are the key properties of 3-(4-bromophenyl)-2,5-dichlorobenzenethiol?
3-(4-bromophenyl)-2,5-dichlorobenzenethiol has a molecular weight of 334.07 g/mol, XLogP of 5.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-2,5-dichlorobenzenethiol is sourced from PubChem (CID 57142660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).