C10H13NO3 — CID 57142968
3-amino-3-hydroxy-4a,7,8,8a-tetrahydro-2H-naphthalene-1,4-dione (PubChem CID 57142968) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-amino-3-hydroxy-4a,7,8,8a-tetrahydro-2H-naphthalene-1,4-dione.
| Compound Name | 3-amino-3-hydroxy-4a,7,8,8a-tetrahydro-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 57142968 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-amino-3-hydroxy-4a,7,8,8a-tetrahydro-2H-naphthalene-1,4-dione |
| SMILES | NC1(O)CC(=O)C2CCC=CC2C1=O |
| InChI | InChI=1S/C10H13NO3/c11-10(14)5-8(12)6-3-1-2-4-7(6)9(10)13/h2,4,6-7,14H,1,3,5,11H2 |
| InChIKey | LKSIWBPNRZCTSJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|