C14H13ClN2O5S2 — CID 57143852
methyl 4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-oxopiperazine-1-carboxylate (PubChem CID 57143852) has the molecular formula C14H13ClN2O5S2 and a molecular weight of 388.85 g/mol. Its IUPAC name is methyl 4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-oxopiperazine-1-carboxylate.
| Compound Name | methyl 4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 57143852 |
| Molecular Formula | C14H13ClN2O5S2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | methyl 4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-oxopiperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(S(=O)(=O)c2cc3ccc(Cl)cc3s2)CC1=O |
| InChI | InChI=1S/C14H13ClN2O5S2/c1-22-14(19)17-5-4-16(8-12(17)18)24(20,21)13-6-9-2-3-10(15)7-11(9)23-13/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | QRKSGETVMGBWPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |