C23H24F6N2O2 — CID 57144282
N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-phenylpiperidin-3-yl)ethyl]formamide (PubChem CID 57144282) has the molecular formula C23H24F6N2O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-phenylpiperidin-3-yl)ethyl]formamide.
| Compound Name | N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-phenylpiperidin-3-yl)ethyl]formamide |
|---|---|
| PubChem CID | 57144282 |
| Molecular Formula | C23H24F6N2O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-phenylpiperidin-3-yl)ethyl]formamide |
| SMILES | O=CNC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCNC1c1ccccc1 |
| InChI | InChI=1S/C23H24F6N2O2/c24-22(25,26)17-9-15(10-18(11-17)23(27,28)29)12-33-13-20(31-14-32)19-7-4-8-30-21(19)16-5-2-1-3-6-16/h1-3,5-6,9-11,14,19-21,30H,4,7-8,12-13H2,(H,31,32) |
| InChIKey | UZCHGGQDLSSVTP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|