C13H25N3O — CID 57144402
4-[1-(2-ethoxyethyl)imidazol-2-yl]-N,N-dimethylbutan-1-amine (PubChem CID 57144402) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-[1-(2-ethoxyethyl)imidazol-2-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[1-(2-ethoxyethyl)imidazol-2-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 57144402 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-[1-(2-ethoxyethyl)imidazol-2-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CCOCCn1ccnc1CCCCN(C)C |
| InChI | InChI=1S/C13H25N3O/c1-4-17-12-11-16-10-8-14-13(16)7-5-6-9-15(2)3/h8,10H,4-7,9,11-12H2,1-3H3 |
| InChIKey | BHVNGGHCLRXPOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|