C15H13F4NO3 — CID 57144625
ethyl 2-(cyclopropanecarboximidoyl)-3-oxo-3-(2,3,4,6-tetrafluorophenyl)propanoate (PubChem CID 57144625) has the molecular formula C15H13F4NO3 and a molecular weight of 331.27 g/mol. Its IUPAC name is ethyl 2-(cyclopropanecarboximidoyl)-3-oxo-3-(2,3,4,6-tetrafluorophenyl)propanoate.
| Compound Name | ethyl 2-(cyclopropanecarboximidoyl)-3-oxo-3-(2,3,4,6-tetrafluorophenyl)propanoate |
|---|---|
| PubChem CID | 57144625 |
| Molecular Formula | C15H13F4NO3 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | ethyl 2-(cyclopropanecarboximidoyl)-3-oxo-3-(2,3,4,6-tetrafluorophenyl)propanoate |
| SMILES | [H]/N=C(\C1CC1)C(C(=O)OCC)C(=O)c1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C15H13F4NO3/c1-2-23-15(22)10(13(20)6-3-4-6)14(21)9-7(16)5-8(17)11(18)12(9)19/h5-6,10,20H,2-4H2,1H3/b20-13+ |
| InChIKey | HLCCKKPCUFTTJZ-DEDYPNTBSA-N |
| XLogP | 3.03 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|