C10H17NO — CID 57145358
6-imino-2,2,4,4-tetramethylcyclohexan-1-one (PubChem CID 57145358) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-imino-2,2,4,4-tetramethylcyclohexan-1-one.
| Compound Name | 6-imino-2,2,4,4-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 57145358 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 6-imino-2,2,4,4-tetramethylcyclohexan-1-one |
| SMILES | [H]/N=C1\CC(C)(C)CC(C)(C)C1=O |
| InChI | InChI=1S/C10H17NO/c1-9(2)5-7(11)8(12)10(3,4)6-9/h11H,5-6H2,1-4H3/b11-7+ |
| InChIKey | WUNPFWKTNFOPOC-YRNVUSSQSA-N |
| XLogP | 2.42 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|