C13H20N4S6 — CID 57145398
5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]nonylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 57145398) has the molecular formula C13H20N4S6 and a molecular weight of 424.73 g/mol. Its IUPAC name is 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]nonylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]nonylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 57145398 |
| Molecular Formula | C13H20N4S6 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 5-[1-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]nonylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCCCCCC(Sc1n[nH]c(=S)s1)Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C13H20N4S6/c1-2-3-4-5-6-7-8-9(20-12-16-14-10(18)22-12)21-13-17-15-11(19)23-13/h9H,2-8H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | HFXFELRWGWPQSU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|