C24H32FNO4S — CID 57145784
7-[3-[2-(4-fluorophenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid (PubChem CID 57145784) has the molecular formula C24H32FNO4S and a molecular weight of 449.59 g/mol. Its IUPAC name is 7-[3-[2-(4-fluorophenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-(4-fluorophenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57145784 |
| Molecular Formula | C24H32FNO4S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 7-[3-[2-(4-fluorophenyl)ethylsulfonylamino]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoic acid |
| SMILES | CC1(C)C2CC(NS(=O)(=O)CCc3ccc(F)cc3)=C(CC=CCCCC(=O)O)C1C2 |
| InChI | InChI=1S/C24H32FNO4S/c1-24(2)18-15-21(24)20(7-5-3-4-6-8-23(27)28)22(16-18)26-31(29,30)14-13-17-9-11-19(25)12-10-17/h3,5,9-12,18,21,26H,4,6-8,13-16H2,1-2H3,(H,27,28) |
| InChIKey | OAQHKZXPZKJJOE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|