About 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal
3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal (PubChem CID 57146067) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal.
Molecular Properties
| Compound Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal |
| PubChem CID | 57146067 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal |
| SMILES | COCc1cc(OCCC=O)no1 |
| InChI | InChI=1S/C8H11NO4/c1-11-6-7-5-8(9-13-7)12-4-2-3-10/h3,5H,2,4,6H2,1H3 |
| InChIKey | MXRWZIVCPSPGAC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal?
The IUPAC name of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal (CID 57146067) is 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal.
What is the SMILES notation for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal?
The canonical SMILES for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal is COCc1cc(OCCC=O)no1.
What is the InChIKey of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal?
The InChIKey is MXRWZIVCPSPGAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-11-6-7-5-8(9-13-7)12-4-2-3-10/h3,5H,2,4,6H2,1H3.
What are the key properties of 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal?
3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal has a molecular weight of 185.18 g/mol, XLogP of 0.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]oxy]propanal is sourced from PubChem (CID 57146067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).