C42H64N2O6 — CID 57146278
bis[1-(2-cyclopentylphenoxy)-3-(3,3-dimethylbutan-2-ylamino)propyl] oxalate (PubChem CID 57146278) has the molecular formula C42H64N2O6 and a molecular weight of 692.98 g/mol. Its IUPAC name is bis[1-(2-cyclopentylphenoxy)-3-(3,3-dimethylbutan-2-ylamino)propyl] oxalate.
| Compound Name | bis[1-(2-cyclopentylphenoxy)-3-(3,3-dimethylbutan-2-ylamino)propyl] oxalate |
|---|---|
| PubChem CID | 57146278 |
| Molecular Formula | C42H64N2O6 |
| Molecular Weight | 692.98 g/mol |
| Exact Mass | 692.48 |
| IUPAC Name | bis[1-(2-cyclopentylphenoxy)-3-(3,3-dimethylbutan-2-ylamino)propyl] oxalate |
| SMILES | CC(NCCC(OC(=O)C(=O)OC(CCNC(C)C(C)(C)C)Oc1ccccc1C1CCCC1)Oc1ccccc1C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C42H64N2O6/c1-29(41(3,4)5)43-27-25-37(47-35-23-15-13-21-33(35)31-17-9-10-18-31)49-39(45)40(46)50-38(26-28-44-30(2)42(6,7)8)48-36-24-16-14-22-34(36)32-19-11-12-20-32/h13-16,21-24,29-32,37-38,43-44H,9-12,17-20,25-28H2,1-8H3 |
| InChIKey | DBWRCAITRJEFMT-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.98 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|