About N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide
N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 57146308) has the molecular formula C16H17Cl2N3O5S2
and a molecular weight of 466.37 g/mol. Its IUPAC name is N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide |
| PubChem CID | 57146308 |
| Molecular Formula | C16H17Cl2N3O5S2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(S(=O)(=O)NN2CCC2)cc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O5S2/c1-27(22,23)19-14-5-4-12(28(24,25)20-21-7-2-8-21)10-16(14)26-15-6-3-11(17)9-13(15)18/h3-6,9-10,19-20H,2,7-8H2,1H3 |
| InChIKey | ZMBZSWKNJVHPRI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide?
The IUPAC name of N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide (CID 57146308) is N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide.
What is the SMILES notation for N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide?
The canonical SMILES for N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide is CS(=O)(=O)Nc1ccc(S(=O)(=O)NN2CCC2)cc1Oc1ccc(Cl)cc1Cl.
What is the InChIKey of N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide?
The InChIKey is ZMBZSWKNJVHPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N3O5S2/c1-27(22,23)19-14-5-4-12(28(24,25)20-21-7-2-8-21)10-16(14)26-15-6-3-11(17)9-13(15)18/h3-6,9-10,19-20H,2,7-8H2,1H3.
What are the key properties of N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide?
N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide has a molecular weight of 466.37 g/mol, XLogP of 3.06, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-1-yl)-3-(2,4-dichlorophenoxy)-4-(methanesulfonamido)benzenesulfonamide is sourced from PubChem (CID 57146308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).