About 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol
2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol (PubChem CID 57146468) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol.
Molecular Properties
| Compound Name | 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol |
| PubChem CID | 57146468 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol |
| SMILES | OCC=c1ccccc1=CCO |
| InChI | InChI=1S/C10H12O2/c11-7-5-9-3-1-2-4-10(9)6-8-12/h1-6,11-12H,7-8H2 |
| InChIKey | TZNSIJILRATGAQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol?
The IUPAC name of 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol (CID 57146468) is 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol.
What is the SMILES notation for 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol?
The canonical SMILES for 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol is OCC=c1ccccc1=CCO.
What is the InChIKey of 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol?
The InChIKey is TZNSIJILRATGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c11-7-5-9-3-1-2-4-10(9)6-8-12/h1-6,11-12H,7-8H2.
What are the key properties of 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol?
2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol has a molecular weight of 164.20 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-hydroxyethylidene)cyclohexa-2,4-dien-1-ylidene]ethanol is sourced from PubChem (CID 57146468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).