About N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide
N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide (PubChem CID 57146503) has the molecular formula C18H38N2O2S
and a molecular weight of 346.58 g/mol. Its IUPAC name is N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide |
| PubChem CID | 57146503 |
| Molecular Formula | C18H38N2O2S |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC[C@@H](CC[C@H](N)CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C18H38N2O2S/c1-4-12-23(21,22)20-14-17(15(2)3)10-11-18(19)13-16-8-6-5-7-9-16/h15-18,20H,4-14,19H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | ZJSUPCPAORPNES-MSOLQXFVSA-N |
| XLogP | 3.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide?
The IUPAC name of N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide (CID 57146503) is N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide.
What is the SMILES notation for N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide?
The canonical SMILES for N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide is CCCS(=O)(=O)NC[C@@H](CC[C@H](N)CC1CCCCC1)C(C)C.
What is the InChIKey of N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide?
The InChIKey is ZJSUPCPAORPNES-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H38N2O2S/c1-4-12-23(21,22)20-14-17(15(2)3)10-11-18(19)13-16-8-6-5-7-9-16/h15-18,20H,4-14,19H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide?
N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide has a molecular weight of 346.58 g/mol, XLogP of 3.67, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,5S)-5-amino-6-cyclohexyl-2-propan-2-ylhexyl]propane-1-sulfonamide is sourced from PubChem (CID 57146503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).