C24H36O8Si — CID 57146867
1-[dimethyl(4,7,10-trioxoundecanoyl)silyl]undecane-1,4,7,10-tetrone (PubChem CID 57146867) has the molecular formula C24H36O8Si and a molecular weight of 480.63 g/mol. Its IUPAC name is 1-[dimethyl(4,7,10-trioxoundecanoyl)silyl]undecane-1,4,7,10-tetrone.
| Compound Name | 1-[dimethyl(4,7,10-trioxoundecanoyl)silyl]undecane-1,4,7,10-tetrone |
|---|---|
| PubChem CID | 57146867 |
| Molecular Formula | C24H36O8Si |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 1-[dimethyl(4,7,10-trioxoundecanoyl)silyl]undecane-1,4,7,10-tetrone |
| SMILES | CC(=O)CCC(=O)CCC(=O)CCC(=O)[Si](C)(C)C(=O)CCC(=O)CCC(=O)CCC(C)=O |
| InChI | InChI=1S/C24H36O8Si/c1-17(25)5-7-19(27)9-11-21(29)13-15-23(31)33(3,4)24(32)16-14-22(30)12-10-20(28)8-6-18(2)26/h5-16H2,1-4H3 |
| InChIKey | LISNQDLCDYYXNQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|