About cyclopropylmethyl 2-benzhydryloxyacetate
cyclopropylmethyl 2-benzhydryloxyacetate (PubChem CID 57147359) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is cyclopropylmethyl 2-benzhydryloxyacetate.
Molecular Properties
| Compound Name | cyclopropylmethyl 2-benzhydryloxyacetate |
| PubChem CID | 57147359 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | cyclopropylmethyl 2-benzhydryloxyacetate |
| SMILES | O=C(COC(c1ccccc1)c1ccccc1)OCC1CC1 |
| InChI | InChI=1S/C19H20O3/c20-18(21-13-15-11-12-15)14-22-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2 |
| InChIKey | UTJMJDXLLTXAQV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropylmethyl 2-benzhydryloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 2-benzhydryloxyacetate?
The IUPAC name of cyclopropylmethyl 2-benzhydryloxyacetate (CID 57147359) is cyclopropylmethyl 2-benzhydryloxyacetate.
What is the SMILES notation for cyclopropylmethyl 2-benzhydryloxyacetate?
The canonical SMILES for cyclopropylmethyl 2-benzhydryloxyacetate is O=C(COC(c1ccccc1)c1ccccc1)OCC1CC1.
What is the InChIKey of cyclopropylmethyl 2-benzhydryloxyacetate?
The InChIKey is UTJMJDXLLTXAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O3/c20-18(21-13-15-11-12-15)14-22-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,19H,11-14H2.
What are the key properties of cyclopropylmethyl 2-benzhydryloxyacetate?
cyclopropylmethyl 2-benzhydryloxyacetate has a molecular weight of 296.37 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 2-benzhydryloxyacetate is sourced from PubChem (CID 57147359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).