C15H19NO5 — CID 57147808
3-phenylpropanoyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboperoxoate (PubChem CID 57147808) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-phenylpropanoyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboperoxoate.
| Compound Name | 3-phenylpropanoyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboperoxoate |
|---|---|
| PubChem CID | 57147808 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-phenylpropanoyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboperoxoate |
| SMILES | O=C(CCc1ccccc1)OOC(=O)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C15H19NO5/c17-11-13-7-4-10-16(13)15(19)21-20-14(18)9-8-12-5-2-1-3-6-12/h1-3,5-6,13,17H,4,7-11H2/t13-/m1/s1 |
| InChIKey | GDWSXRMQIJWNHQ-CYBMUJFWSA-N |
| XLogP | 1.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|