About tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate
tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate (PubChem CID 57148197) has the molecular formula C27H29F3O6S2
and a molecular weight of 570.65 g/mol. Its IUPAC name is tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
| PubChem CID | 57148197 |
| Molecular Formula | C27H29F3O6S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
| SMILES | Cc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H29F3O6S2/c1-19-6-12-22(13-7-19)37(23-14-8-20(2)9-15-23,36-38(32,33)27(28,29)30)24-16-10-21(11-17-24)34-18-25(31)35-26(3,4)5/h6-17H,18H2,1-5H3 |
| InChIKey | UFQORAOWCWCWSN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate?
The IUPAC name of tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate (CID 57148197) is tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate.
What is the SMILES notation for tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate?
The canonical SMILES for tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate is Cc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1.
What is the InChIKey of tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate?
The InChIKey is UFQORAOWCWCWSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F3O6S2/c1-19-6-12-22(13-7-19)37(23-14-8-20(2)9-15-23,36-38(32,33)27(28,29)30)24-16-10-21(11-17-24)34-18-25(31)35-26(3,4)5/h6-17H,18H2,1-5H3.
What are the key properties of tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate?
tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate has a molecular weight of 570.65 g/mol, XLogP of 7.09, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[bis(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate is sourced from PubChem (CID 57148197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).